C12H13F2NO3 — CID 106492239
3,3-difluoro-5-[(2-methoxyanilino)methyl]oxolan-2-one (PubChem CID 106492239) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 3,3-difluoro-5-[(2-methoxyanilino)methyl]oxolan-2-one.
| Compound Name | 3,3-difluoro-5-[(2-methoxyanilino)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 106492239 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3,3-difluoro-5-[(2-methoxyanilino)methyl]oxolan-2-one |
| SMILES | COc1ccccc1NCC1CC(F)(F)C(=O)O1 |
| InChI | InChI=1S/C12H13F2NO3/c1-17-10-5-3-2-4-9(10)15-7-8-6-12(13,14)11(16)18-8/h2-5,8,15H,6-7H2,1H3 |
| InChIKey | XULLMBJSAPBLBK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |