C12H10F2N2O2 — CID 106492310
4-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]benzonitrile (PubChem CID 106492310) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is 4-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]benzonitrile.
| Compound Name | 4-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 106492310 |
| Molecular Formula | C12H10F2N2O2 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-[(4,4-difluoro-5-oxooxolan-2-yl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCC2CC(F)(F)C(=O)O2)cc1 |
| InChI | InChI=1S/C12H10F2N2O2/c13-12(14)5-10(18-11(12)17)7-16-9-3-1-8(6-15)2-4-9/h1-4,10,16H,5,7H2 |
| InChIKey | MPIZLWZSPBAPRF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |