C12H12BrF2NO3 — CID 106492836
5-[(3-bromo-5-methoxyanilino)methyl]-3,3-difluorooxolan-2-one (PubChem CID 106492836) has the molecular formula C12H12BrF2NO3 and a molecular weight of 336.13 g/mol. Its IUPAC name is 5-[(3-bromo-5-methoxyanilino)methyl]-3,3-difluorooxolan-2-one.
| Compound Name | 5-[(3-bromo-5-methoxyanilino)methyl]-3,3-difluorooxolan-2-one |
|---|---|
| PubChem CID | 106492836 |
| Molecular Formula | C12H12BrF2NO3 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-[(3-bromo-5-methoxyanilino)methyl]-3,3-difluorooxolan-2-one |
| SMILES | COc1cc(Br)cc(NCC2CC(F)(F)C(=O)O2)c1 |
| InChI | InChI=1S/C12H12BrF2NO3/c1-18-9-3-7(13)2-8(4-9)16-6-10-5-12(14,15)11(17)19-10/h2-4,10,16H,5-6H2,1H3 |
| InChIKey | WOJVQQZZYDLOTN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |