C13H17NO4 — CID 175531928
methyl 2-methoxy-5-(oxetan-2-ylmethylamino)benzoate (PubChem CID 175531928) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is methyl 2-methoxy-5-(oxetan-2-ylmethylamino)benzoate.
| Compound Name | methyl 2-methoxy-5-(oxetan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 175531928 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | methyl 2-methoxy-5-(oxetan-2-ylmethylamino)benzoate |
| SMILES | COC(=O)c1cc(NCC2CCO2)ccc1OC |
| InChI | InChI=1S/C13H17NO4/c1-16-12-4-3-9(7-11(12)13(15)17-2)14-8-10-5-6-18-10/h3-4,7,10,14H,5-6,8H2,1-2H3 |
| InChIKey | OWUGOSGGSUKEQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|