C20H25N3O5 — CID 113025389
3,4,5-trimethoxy-N-[5-(oxolan-2-ylmethylamino)-2-pyridinyl]benzamide (PubChem CID 113025389) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-(oxolan-2-ylmethylamino)-2-pyridinyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-(oxolan-2-ylmethylamino)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113025389 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-(oxolan-2-ylmethylamino)-2-pyridinyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(NCC3CCCO3)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O5/c1-25-16-9-13(10-17(26-2)19(16)27-3)20(24)23-18-7-6-14(11-22-18)21-12-15-5-4-8-28-15/h6-7,9-11,15,21H,4-5,8,12H2,1-3H3,(H,22,23,24) |
| InChIKey | QRYRZONTRAYOHT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |