C8H11F3O3S — CID 114994188
4-(2,2,2-trifluoroethoxy)thiane-4-carboxylic acid (PubChem CID 114994188) has the molecular formula C8H11F3O3S and a molecular weight of 244.23 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxy)thiane-4-carboxylic acid.
| Compound Name | 4-(2,2,2-trifluoroethoxy)thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 114994188 |
| Molecular Formula | C8H11F3O3S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxy)thiane-4-carboxylic acid |
| SMILES | O=C(O)C1(OCC(F)(F)F)CCSCC1 |
| InChI | InChI=1S/C8H11F3O3S/c9-8(10,11)5-14-7(6(12)13)1-3-15-4-2-7/h1-5H2,(H,12,13) |
| InChIKey | WVIXWCDCUUGFHW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |