C17H12F8INO4 — CID 154361518
3,5-difluoro-6-hydroxy-4-iodo-N-phenyl-3,6-bis(2,2,2-trifluoroethoxy)cyclohexa-1,4-diene-1-carboxamide (PubChem CID 154361518) has the molecular formula C17H12F8INO4 and a molecular weight of 573.17 g/mol. Its IUPAC name is 3,5-difluoro-6-hydroxy-4-iodo-N-phenyl-3,6-bis(2,2,2-trifluoroethoxy)cyclohexa-1,4-diene-1-carboxamide.
| Compound Name | 3,5-difluoro-6-hydroxy-4-iodo-N-phenyl-3,6-bis(2,2,2-trifluoroethoxy)cyclohexa-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 154361518 |
| Molecular Formula | C17H12F8INO4 |
| Molecular Weight | 573.17 g/mol |
| Exact Mass | 572.97 |
| IUPAC Name | 3,5-difluoro-6-hydroxy-4-iodo-N-phenyl-3,6-bis(2,2,2-trifluoroethoxy)cyclohexa-1,4-diene-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=CC(F)(OCC(F)(F)F)C(I)=C(F)C1(O)OCC(F)(F)F |
| InChI | InChI=1S/C17H12F8INO4/c18-11-12(26)14(19,30-7-15(20,21)22)6-10(17(11,29)31-8-16(23,24)25)13(28)27-9-4-2-1-3-5-9/h1-6,29H,7-8H2,(H,27,28) |
| InChIKey | OTQBDDLVBDRYKP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|