C16H15F3N4O2 — CID 134123915
3-phenyl-1-(phenylcarbamoylamino)-1-(2,2,2-trifluoroethyl)urea (PubChem CID 134123915) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 3-phenyl-1-(phenylcarbamoylamino)-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-phenyl-1-(phenylcarbamoylamino)-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 134123915 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-phenyl-1-(phenylcarbamoylamino)-1-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(Nc1ccccc1)NN(CC(F)(F)F)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15F3N4O2/c17-16(18,19)11-23(15(25)21-13-9-5-2-6-10-13)22-14(24)20-12-7-3-1-4-8-12/h1-10H,11H2,(H,21,25)(H2,20,22,24) |
| InChIKey | AJTAHBLJCOTYPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|