C10H11F3NO2P — CID 134318906
N-[ethenyl(2,2,2-trifluoroethoxy)phosphoryl]aniline (PubChem CID 134318906) has the molecular formula C10H11F3NO2P and a molecular weight of 265.17 g/mol. Its IUPAC name is N-[ethenyl(2,2,2-trifluoroethoxy)phosphoryl]aniline.
| Compound Name | N-[ethenyl(2,2,2-trifluoroethoxy)phosphoryl]aniline |
|---|---|
| PubChem CID | 134318906 |
| Molecular Formula | C10H11F3NO2P |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-[ethenyl(2,2,2-trifluoroethoxy)phosphoryl]aniline |
| SMILES | C=CP(=O)(Nc1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C10H11F3NO2P/c1-2-17(15,16-8-10(11,12)13)14-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,14,15) |
| InChIKey | CTYDJMCBYIWLIK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|