C12H16F3O2P — CID 66796378
[butyl(2,2,2-trifluoroethoxy)phosphoryl]benzene (PubChem CID 66796378) has the molecular formula C12H16F3O2P and a molecular weight of 280.23 g/mol. Its IUPAC name is [butyl(2,2,2-trifluoroethoxy)phosphoryl]benzene.
| Compound Name | [butyl(2,2,2-trifluoroethoxy)phosphoryl]benzene |
|---|---|
| PubChem CID | 66796378 |
| Molecular Formula | C12H16F3O2P |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [butyl(2,2,2-trifluoroethoxy)phosphoryl]benzene |
| SMILES | CCCCP(=O)(OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H16F3O2P/c1-2-3-9-18(16,17-10-12(13,14)15)11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3 |
| InChIKey | JABIRCLHDUWISW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|