C11H11F6O4P — CID 102473558
(S)-bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethanol (PubChem CID 102473558) has the molecular formula C11H11F6O4P and a molecular weight of 352.17 g/mol. Its IUPAC name is (S)-bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethanol.
| Compound Name | (S)-bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethanol |
|---|---|
| PubChem CID | 102473558 |
| Molecular Formula | C11H11F6O4P |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (S)-bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethanol |
| SMILES | O=P(OCC(F)(F)F)(OCC(F)(F)F)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H11F6O4P/c12-10(13,14)6-20-22(19,21-7-11(15,16)17)9(18)8-4-2-1-3-5-8/h1-5,9,18H,6-7H2/t9-/m0/s1 |
| InChIKey | NBJOQOVWKAMLDS-VIFPVBQESA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|