C19H19F6N2O3P — CID 71612785
2-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]-2-(2-methylbut-3-en-2-yl)propanedinitrile (PubChem CID 71612785) has the molecular formula C19H19F6N2O3P and a molecular weight of 468.33 g/mol. Its IUPAC name is 2-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]-2-(2-methylbut-3-en-2-yl)propanedinitrile.
| Compound Name | 2-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]-2-(2-methylbut-3-en-2-yl)propanedinitrile |
|---|---|
| PubChem CID | 71612785 |
| Molecular Formula | C19H19F6N2O3P |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-[bis(2,2,2-trifluoroethoxy)phosphoryl-phenylmethyl]-2-(2-methylbut-3-en-2-yl)propanedinitrile |
| SMILES | C=CC(C)(C)C(C#N)(C#N)C(c1ccccc1)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C19H19F6N2O3P/c1-4-16(2,3)17(10-26,11-27)15(14-8-6-5-7-9-14)31(28,29-12-18(20,21)22)30-13-19(23,24)25/h4-9,15H,1,12-13H2,2-3H3 |
| InChIKey | BZBWRSBIKHEKOJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|