About (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate
(2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate (PubChem CID 162575664) has the molecular formula C16H13F6O4P
and a molecular weight of 414.24 g/mol. Its IUPAC name is (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate.
Molecular Properties
| Compound Name | (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate |
| PubChem CID | 162575664 |
| Molecular Formula | C16H13F6O4P |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate |
| SMILES | O=P(OCC(F)(F)F)(OCC(F)(F)F)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H13F6O4P/c17-15(18,19)10-24-27(23,25-11-16(20,21)22)26-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9H,10-11H2 |
| InChIKey | POIPJRDCAFVLLQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate?
The IUPAC name of (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate (CID 162575664) is (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate.
What is the SMILES notation for (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate?
The canonical SMILES for (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate is O=P(OCC(F)(F)F)(OCC(F)(F)F)Oc1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate?
The InChIKey is POIPJRDCAFVLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F6O4P/c17-15(18,19)10-24-27(23,25-11-16(20,21)22)26-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9H,10-11H2.
What are the key properties of (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate?
(2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate has a molecular weight of 414.24 g/mol, XLogP of 6.00, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl) bis(2,2,2-trifluoroethyl) phosphate is sourced from PubChem (CID 162575664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).