C12H14F2N2O3 — CID 175183183
(5-anilino-4,4-difluoro-5-oxopentyl) carbamate (PubChem CID 175183183) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is (5-anilino-4,4-difluoro-5-oxopentyl) carbamate.
| Compound Name | (5-anilino-4,4-difluoro-5-oxopentyl) carbamate |
|---|---|
| PubChem CID | 175183183 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (5-anilino-4,4-difluoro-5-oxopentyl) carbamate |
| SMILES | NC(=O)OCCCC(F)(F)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H14F2N2O3/c13-12(14,7-4-8-19-11(15)18)10(17)16-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,15,18)(H,16,17) |
| InChIKey | IBANTVUBYDFZBP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|