C15H8F7NO2 — CID 18208238
2,3,4,5-tetrafluoro-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 18208238) has the molecular formula C15H8F7NO2 and a molecular weight of 367.22 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 18208238 |
| Molecular Formula | C15H8F7NO2 |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)cc1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F7NO2/c16-10-5-9(11(17)13(19)12(10)18)14(24)23-7-1-3-8(4-2-7)25-6-15(20,21)22/h1-5H,6H2,(H,23,24) |
| InChIKey | ABDQTPKWXFNTIR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|