About 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene
5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 59310354) has the molecular formula C14H15F5O3
and a molecular weight of 326.26 g/mol. Its IUPAC name is 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene.
Molecular Properties
| Compound Name | 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene |
| PubChem CID | 59310354 |
| Molecular Formula | C14H15F5O3 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | FC(F)(F)C1(OC2CCCO2)OC2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C14H15F5O3/c15-12(16)10-7-3-4-8(6-7)11(10)22-13(12,14(17,18)19)21-9-2-1-5-20-9/h3-4,7-11H,1-2,5-6H2 |
| InChIKey | YFIHLQGMWARURY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene?
The IUPAC name of 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene (CID 59310354) is 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene.
What is the SMILES notation for 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene?
The canonical SMILES for 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene is FC(F)(F)C1(OC2CCCO2)OC2C3C=CC(C3)C2C1(F)F.
What is the InChIKey of 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene?
The InChIKey is YFIHLQGMWARURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F5O3/c15-12(16)10-7-3-4-8(6-7)11(10)22-13(12,14(17,18)19)21-9-2-1-5-20-9/h3-4,7-11H,1-2,5-6H2.
What are the key properties of 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene?
5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene has a molecular weight of 326.26 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-4-(oxolan-2-yloxy)-4-(trifluoromethyl)-3-oxatricyclo[5.2.1.02,6]dec-8-ene is sourced from PubChem (CID 59310354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).