C9H10F6O2 — CID 172858111
1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)propane-1,1-diol (PubChem CID 172858111) has the molecular formula C9H10F6O2 and a molecular weight of 264.17 g/mol. Its IUPAC name is 1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)propane-1,1-diol.
| Compound Name | 1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 172858111 |
| Molecular Formula | C9H10F6O2 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)propane-1,1-diol |
| SMILES | CCC(O)(O)C1(F)C=CC(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F6O2/c1-2-7(16,17)6(11)4-3-5(10)8(12,13)9(6,14)15/h3-5,16-17H,2H2,1H3 |
| InChIKey | YZIFTBRQWXTKOK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|