C10H12F4O2 — CID 162604225
3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol (PubChem CID 162604225) has the molecular formula C10H12F4O2 and a molecular weight of 240.20 g/mol. Its IUPAC name is 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol.
| Compound Name | 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol |
|---|---|
| PubChem CID | 162604225 |
| Molecular Formula | C10H12F4O2 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-but-2-enyl-2,2,5,5-tetrafluoro-4-methylcyclopent-3-ene-1,1-diol |
| SMILES | CC=CCC1=C(C)C(F)(F)C(O)(O)C1(F)F |
| InChI | InChI=1S/C10H12F4O2/c1-3-4-5-7-6(2)8(11,12)10(15,16)9(7,13)14/h3-4,15-16H,5H2,1-2H3 |
| InChIKey | DJELDMPDHKZVGW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|