C10H11F7O — CID 139896569
1-fluoro-1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)-2-methylpropan-1-ol (PubChem CID 139896569) has the molecular formula C10H11F7O and a molecular weight of 280.18 g/mol. Its IUPAC name is 1-fluoro-1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)-2-methylpropan-1-ol.
| Compound Name | 1-fluoro-1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 139896569 |
| Molecular Formula | C10H11F7O |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-fluoro-1-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)-2-methylpropan-1-ol |
| SMILES | CC(C)C(O)(F)C1(F)C=CC(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H11F7O/c1-5(2)9(15,18)7(12)4-3-6(11)8(13,14)10(7,16)17/h3-6,18H,1-2H3 |
| InChIKey | OCZBYAAHOHNMEM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|