C9H9F5O — CID 70985483
8,8-difluoro-7-(trifluoromethyl)bicyclo[4.2.0]oct-3-en-7-ol (PubChem CID 70985483) has the molecular formula C9H9F5O and a molecular weight of 228.16 g/mol. Its IUPAC name is 8,8-difluoro-7-(trifluoromethyl)bicyclo[4.2.0]oct-3-en-7-ol.
| Compound Name | 8,8-difluoro-7-(trifluoromethyl)bicyclo[4.2.0]oct-3-en-7-ol |
|---|---|
| PubChem CID | 70985483 |
| Molecular Formula | C9H9F5O |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8,8-difluoro-7-(trifluoromethyl)bicyclo[4.2.0]oct-3-en-7-ol |
| SMILES | OC1(C(F)(F)F)C2CC=CCC2C1(F)F |
| InChI | InChI=1S/C9H9F5O/c10-8(11)6-4-2-1-3-5(6)7(8,15)9(12,13)14/h1-2,5-6,15H,3-4H2 |
| InChIKey | XFVMGBOUDAWDHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|