C12H18F6O — CID 88575381
(Z)-1,1,1-trifluoro-2-(trifluoromethyl)undec-7-en-2-ol (PubChem CID 88575381) has the molecular formula C12H18F6O and a molecular weight of 292.26 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-2-(trifluoromethyl)undec-7-en-2-ol.
| Compound Name | (Z)-1,1,1-trifluoro-2-(trifluoromethyl)undec-7-en-2-ol |
|---|---|
| PubChem CID | 88575381 |
| Molecular Formula | C12H18F6O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (Z)-1,1,1-trifluoro-2-(trifluoromethyl)undec-7-en-2-ol |
| SMILES | CCC/C=C\CCCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6O/c1-2-3-4-5-6-7-8-9-10(19,11(13,14)15)12(16,17)18/h4-5,19H,2-3,6-9H2,1H3/b5-4- |
| InChIKey | WQUJVHNDQOEKED-PLNGDYQASA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|