C12H18F4O2 — CID 176556800
(E)-3-cyclohexyl-1,1,1,3-tetrafluorohex-4-ene-2,2-diol (PubChem CID 176556800) has the molecular formula C12H18F4O2 and a molecular weight of 270.27 g/mol. Its IUPAC name is (E)-3-cyclohexyl-1,1,1,3-tetrafluorohex-4-ene-2,2-diol.
| Compound Name | (E)-3-cyclohexyl-1,1,1,3-tetrafluorohex-4-ene-2,2-diol |
|---|---|
| PubChem CID | 176556800 |
| Molecular Formula | C12H18F4O2 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (E)-3-cyclohexyl-1,1,1,3-tetrafluorohex-4-ene-2,2-diol |
| SMILES | C/C=C/C(F)(C1CCCCC1)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H18F4O2/c1-2-8-10(13,9-6-4-3-5-7-9)11(17,18)12(14,15)16/h2,8-9,17-18H,3-7H2,1H3/b8-2+ |
| InChIKey | WGEBIRYUTIPFKF-KRXBUXKQSA-N |
| XLogP | 3.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|