C19H30F6O — CID 123992252
1,1,1,3,3,3-hexafluoro-2-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohex-2-en-1-yl]propan-2-ol (PubChem CID 123992252) has the molecular formula C19H30F6O and a molecular weight of 388.44 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohex-2-en-1-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohex-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 123992252 |
| Molecular Formula | C19H30F6O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohex-2-en-1-yl]propan-2-ol |
| SMILES | CC(C)(C)CC(C1C=CC(C(O)(C(F)(F)F)C(F)(F)F)CC1)C(C)(C)C |
| InChI | InChI=1S/C19H30F6O/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)17(26,18(20,21)22)19(23,24)25/h7,9,12-14,26H,8,10-11H2,1-6H3 |
| InChIKey | GCJXBEGNOXJTEE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|