C16H18F12O2 — CID 141392734
1,1,1-trifluoro-6-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-(trifluoromethyl)hex-4-en-2-ol (PubChem CID 141392734) has the molecular formula C16H18F12O2 and a molecular weight of 470.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-(trifluoromethyl)hex-4-en-2-ol.
| Compound Name | 1,1,1-trifluoro-6-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-(trifluoromethyl)hex-4-en-2-ol |
|---|---|
| PubChem CID | 141392734 |
| Molecular Formula | C16H18F12O2 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1,1,1-trifluoro-6-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]-2-(trifluoromethyl)hex-4-en-2-ol |
| SMILES | OC(CC=CCC1CCCC(C(O)(C(F)(F)F)C(F)(F)F)C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H18F12O2/c17-13(18,19)11(29,14(20,21)22)7-2-1-4-9-5-3-6-10(8-9)12(30,15(23,24)25)16(26,27)28/h1-2,9-10,29-30H,3-8H2 |
| InChIKey | FBVBJNCHBNJJEI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|