C16H17F11O — CID 74067355
3-(3-cyclohexylprop-2-enyl)-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 74067355) has the molecular formula C16H17F11O and a molecular weight of 434.29 g/mol. Its IUPAC name is 3-(3-cyclohexylprop-2-enyl)-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 3-(3-cyclohexylprop-2-enyl)-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 74067355 |
| Molecular Formula | C16H17F11O |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-(3-cyclohexylprop-2-enyl)-1,1,1,4,4,5,6,6-octafluoro-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(CC=CC1CCCCC1)C(F)(F)C(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17F11O/c17-11(12(18)19)13(20,21)10(8-4-7-9-5-2-1-3-6-9)14(28,15(22,23)24)16(25,26)27/h4,7,9-10,28H,1-3,5-6,8H2 |
| InChIKey | NTCSTJSACNIZSW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|