C17H19F11O — CID 23591067
4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 23591067) has the molecular formula C17H19F11O and a molecular weight of 448.32 g/mol. Its IUPAC name is 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 23591067 |
| Molecular Formula | C17H19F11O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 4-[(E)-3-cyclohexylprop-2-enyl]-1,1,1,5,5,6,7,7-octafluoro-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | OC(CC(C/C=C/C1CCCCC1)C(F)(F)C(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F11O/c18-12(13(19)20)15(21,22)11(8-4-7-10-5-2-1-3-6-10)9-14(29,16(23,24)25)17(26,27)28/h4,7,10-11,29H,1-3,5-6,8-9H2/b7-4+ |
| InChIKey | USHCTSALHUMELY-QPJJXVBHSA-N |
| XLogP | 7.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|