C14H18F6O — CID 23591080
(6E)-7-cyclohexyl-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591080) has the molecular formula C14H18F6O and a molecular weight of 316.29 g/mol. Its IUPAC name is (6E)-7-cyclohexyl-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | (6E)-7-cyclohexyl-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591080 |
| Molecular Formula | C14H18F6O |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (6E)-7-cyclohexyl-1,1,2-trifluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | OC(C/C=C/C1CCCCC1)(CC(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O/c15-11(12(16)17)9-13(21,14(18,19)20)8-4-7-10-5-2-1-3-6-10/h4,7,10,21H,1-3,5-6,8-9H2/b7-4+ |
| InChIKey | VDYRQUDWXPZVMF-QPJJXVBHSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|