C11H20F3NO — CID 115043071
2-(aminomethyl)-3-cycloheptyl-1,1,1-trifluoropropan-2-ol (PubChem CID 115043071) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-(aminomethyl)-3-cycloheptyl-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(aminomethyl)-3-cycloheptyl-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 115043071 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-(aminomethyl)-3-cycloheptyl-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(CC1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c12-11(13,14)10(16,8-15)7-9-5-3-1-2-4-6-9/h9,16H,1-8,15H2 |
| InChIKey | XULBVCZGAYFMPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |