2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid

C10H14F4O2 — CID 115044604

IUPAC2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid
SMILESO=C(O)C(F)(CC1CCCCC1)C(F)(F)F
InChIInChI=1S/C10H14F4O2/c11-9(8(15)16,10(12,13)14)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,15,16)
InChIKeyDXPAZTUWDNGGNT-UHFFFAOYSA-N
MW242.21 g/mol
LogP3.31
Rot. Bonds3

About 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid

2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 115044604) has the molecular formula C10H14F4O2 and a molecular weight of 242.21 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid.

Molecular Properties

Compound Name2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid
PubChem CID115044604
Molecular FormulaC10H14F4O2
Molecular Weight242.21 g/mol
Exact Mass242.09
IUPAC Name2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid
SMILESO=C(O)C(F)(CC1CCCCC1)C(F)(F)F
InChIInChI=1S/C10H14F4O2/c11-9(8(15)16,10(12,13)14)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,15,16)
InChIKeyDXPAZTUWDNGGNT-UHFFFAOYSA-N
XLogP3.31
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.21
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The IUPAC name of 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid (CID 115044604) is 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid.
What is the SMILES notation for 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The canonical SMILES for 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid is O=C(O)C(F)(CC1CCCCC1)C(F)(F)F.
What is the InChIKey of 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The InChIKey is DXPAZTUWDNGGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F4O2/c11-9(8(15)16,10(12,13)14)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,15,16).
What are the key properties of 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid has a molecular weight of 242.21 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethyl)-2,3,3,3-tetrafluoropropanoic acid is sourced from PubChem (CID 115044604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).