C9H12F4O2 — CID 115036499
2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 115036499) has the molecular formula C9H12F4O2 and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid.
| Compound Name | 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 115036499 |
| Molecular Formula | C9H12F4O2 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(CC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H12F4O2/c10-8(7(14)15,9(11,12)13)5-6-3-1-2-4-6/h6H,1-5H2,(H,14,15) |
| InChIKey | UAGIALMDDYOPPG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |