2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid

C9H12F4O2 — CID 115036499

IUPAC2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid
SMILESO=C(O)C(F)(CC1CCCC1)C(F)(F)F
InChIInChI=1S/C9H12F4O2/c10-8(7(14)15,9(11,12)13)5-6-3-1-2-4-6/h6H,1-5H2,(H,14,15)
InChIKeyUAGIALMDDYOPPG-UHFFFAOYSA-N
MW228.18 g/mol
LogP2.92
Rot. Bonds3

About 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid

2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 115036499) has the molecular formula C9H12F4O2 and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid.

Molecular Properties

Compound Name2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid
PubChem CID115036499
Molecular FormulaC9H12F4O2
Molecular Weight228.18 g/mol
Exact Mass228.08
IUPAC Name2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid
SMILESO=C(O)C(F)(CC1CCCC1)C(F)(F)F
InChIInChI=1S/C9H12F4O2/c10-8(7(14)15,9(11,12)13)5-6-3-1-2-4-6/h6H,1-5H2,(H,14,15)
InChIKeyUAGIALMDDYOPPG-UHFFFAOYSA-N
XLogP2.92
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.18
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The IUPAC name of 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid (CID 115036499) is 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid.
What is the SMILES notation for 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The canonical SMILES for 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid is O=C(O)C(F)(CC1CCCC1)C(F)(F)F.
What is the InChIKey of 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
The InChIKey is UAGIALMDDYOPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F4O2/c10-8(7(14)15,9(11,12)13)5-6-3-1-2-4-6/h6H,1-5H2,(H,14,15).
What are the key properties of 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid?
2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid has a molecular weight of 228.18 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylmethyl)-2,3,3,3-tetrafluoropropanoic acid is sourced from PubChem (CID 115036499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).