C9H16Br3NO2 — CID 70540306
carbamic acid;2,2,2-tribromoethylcyclohexane (PubChem CID 70540306) has the molecular formula C9H16Br3NO2 and a molecular weight of 409.94 g/mol. Its IUPAC name is carbamic acid;2,2,2-tribromoethylcyclohexane.
| Compound Name | carbamic acid;2,2,2-tribromoethylcyclohexane |
|---|---|
| PubChem CID | 70540306 |
| Molecular Formula | C9H16Br3NO2 |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 406.87 |
| IUPAC Name | carbamic acid;2,2,2-tribromoethylcyclohexane |
| SMILES | BrC(Br)(Br)CC1CCCCC1.NC(=O)O |
| InChI | InChI=1S/C8H13Br3.CH3NO2/c9-8(10,11)6-7-4-2-1-3-5-7;2-1(3)4/h7H,1-6H2;2H2,(H,3,4) |
| InChIKey | HRMALBZIEKDLSK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|