cyclopentanol;2,2,2-trifluoroacetic acid

C7H11F3O3 — CID 175723828

IUPACcyclopentanol;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.OC1CCCC1
InChIInChI=1S/C5H10O.C2HF3O2/c6-5-3-1-2-4-5;3-2(4,5)1(6)7/h5-6H,1-4H2;(H,6,7)
InChIKeyWYEIVENUXOOJOG-UHFFFAOYSA-N
MW200.16 g/mol
LogP1.55
Rot. Bonds

About cyclopentanol;2,2,2-trifluoroacetic acid

cyclopentanol;2,2,2-trifluoroacetic acid (PubChem CID 175723828) has the molecular formula C7H11F3O3 and a molecular weight of 200.16 g/mol. Its IUPAC name is cyclopentanol;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namecyclopentanol;2,2,2-trifluoroacetic acid
PubChem CID175723828
Molecular FormulaC7H11F3O3
Molecular Weight200.16 g/mol
Exact Mass200.07
IUPAC Namecyclopentanol;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.OC1CCCC1
InChIInChI=1S/C5H10O.C2HF3O2/c6-5-3-1-2-4-5;3-2(4,5)1(6)7/h5-6H,1-4H2;(H,6,7)
InChIKeyWYEIVENUXOOJOG-UHFFFAOYSA-N
XLogP1.55
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.16
LogP ≤ 51.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cyclopentanol;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

bicyclo[2.2.2]octane;bis(2,2,2-trifluoroacetic acid)
CID 87462470
oxophosphanium;2,2,2-trifluoroacetic acid
CID 175810301
acetic acid;cyclohexanol
CID 19963759
cyclopropanamine;bis(2,2,2-trifluoroacetic acid)
CID 162300046
cyclohexane-1,4-diamine;2,2,2-trifluoroacetic acid
CID 68531631
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;silane;2,2,2-trifluoroacetic acid
CID 173308974
cyclooctylhydrazine;2,2,2-trifluoroacetic acid
CID 68818216
2,2,2-trifluoroacetic acid;trihydrofluoride
CID 171927516
azane;tris(2,2,2-trifluoroacetic acid)
CID 175976837
cyclopentanol;hafnium
CID 150405183
azane;pentakis(2,2,2-trifluoroacetic acid)
CID 174693543
pentakis(cyclopentanol);hafnium
CID 142301948

Frequently Asked Questions

What is the IUPAC name of cyclopentanol;2,2,2-trifluoroacetic acid?
The IUPAC name of cyclopentanol;2,2,2-trifluoroacetic acid (CID 175723828) is cyclopentanol;2,2,2-trifluoroacetic acid.
What is the SMILES notation for cyclopentanol;2,2,2-trifluoroacetic acid?
The canonical SMILES for cyclopentanol;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.OC1CCCC1.
What is the InChIKey of cyclopentanol;2,2,2-trifluoroacetic acid?
The InChIKey is WYEIVENUXOOJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C2HF3O2/c6-5-3-1-2-4-5;3-2(4,5)1(6)7/h5-6H,1-4H2;(H,6,7).
What are the key properties of cyclopentanol;2,2,2-trifluoroacetic acid?
cyclopentanol;2,2,2-trifluoroacetic acid has a molecular weight of 200.16 g/mol, XLogP of 1.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanol;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175723828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).