C12H20F3NO4 — CID 70021920
2-amino-4-cyclohexylbutanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70021920) has the molecular formula C12H20F3NO4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-amino-4-cyclohexylbutanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-4-cyclohexylbutanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70021920 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-amino-4-cyclohexylbutanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(CCC1CCCCC1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H19NO2.C2HF3O2/c11-9(10(12)13)7-6-8-4-2-1-3-5-8;3-2(4,5)1(6)7/h8-9H,1-7,11H2,(H,12,13);(H,6,7) |
| InChIKey | JMNGSLHXPRJBBW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |