C11H17F2NO3 — CID 19840695
4-amino-5-cyclohexyl-2,2-difluoro-3-oxopentanoic acid (PubChem CID 19840695) has the molecular formula C11H17F2NO3 and a molecular weight of 249.26 g/mol. Its IUPAC name is 4-amino-5-cyclohexyl-2,2-difluoro-3-oxopentanoic acid.
| Compound Name | 4-amino-5-cyclohexyl-2,2-difluoro-3-oxopentanoic acid |
|---|---|
| PubChem CID | 19840695 |
| Molecular Formula | C11H17F2NO3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-amino-5-cyclohexyl-2,2-difluoro-3-oxopentanoic acid |
| SMILES | NC(CC1CCCCC1)C(=O)C(F)(F)C(=O)O |
| InChI | InChI=1S/C11H17F2NO3/c12-11(13,10(16)17)9(15)8(14)6-7-4-2-1-3-5-7/h7-8H,1-6,14H2,(H,16,17) |
| InChIKey | LNHSRDSMCWBDOQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|