C14H26O2 — CID 87751411
3-(cyclohexylmethyl)-3-hydroxy-4,4-dimethylpentanal (PubChem CID 87751411) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-3-hydroxy-4,4-dimethylpentanal.
| Compound Name | 3-(cyclohexylmethyl)-3-hydroxy-4,4-dimethylpentanal |
|---|---|
| PubChem CID | 87751411 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-(cyclohexylmethyl)-3-hydroxy-4,4-dimethylpentanal |
| SMILES | CC(C)(C)C(O)(CC=O)CC1CCCCC1 |
| InChI | InChI=1S/C14H26O2/c1-13(2,3)14(16,9-10-15)11-12-7-5-4-6-8-12/h10,12,16H,4-9,11H2,1-3H3 |
| InChIKey | NUXWMWAEHDIZNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|