About 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane
2,2-dimethylpropane;2,2-dimethylpropylcyclobutane (PubChem CID 167591215) has the molecular formula C14H30
and a molecular weight of 198.39 g/mol. Its IUPAC name is 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane.
Analyze 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane?
The IUPAC name of 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane (CID 167591215) is 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane.
What is the SMILES notation for 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane?
The canonical SMILES for 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane is CC(C)(C)C.CC(C)(C)CC1CCC1.
What is the InChIKey of 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane?
The InChIKey is ILONOIADSYWMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C5H12/c1-9(2,3)7-8-5-4-6-8;1-5(2,3)4/h8H,4-7H2,1-3H3;1-4H3.
What are the key properties of 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane?
2,2-dimethylpropane;2,2-dimethylpropylcyclobutane has a molecular weight of 198.39 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;2,2-dimethylpropylcyclobutane is sourced from PubChem (CID 167591215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).