C28H58 — CID 160533603
1,4-bis(2,2-dimethylpropyl)cyclohexane;2,2,7,7-tetramethyloctane (PubChem CID 160533603) has the molecular formula C28H58 and a molecular weight of 394.77 g/mol. Its IUPAC name is 1,4-bis(2,2-dimethylpropyl)cyclohexane;2,2,7,7-tetramethyloctane.
| Compound Name | 1,4-bis(2,2-dimethylpropyl)cyclohexane;2,2,7,7-tetramethyloctane |
|---|---|
| PubChem CID | 160533603 |
| Molecular Formula | C28H58 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.45 |
| IUPAC Name | 1,4-bis(2,2-dimethylpropyl)cyclohexane;2,2,7,7-tetramethyloctane |
| SMILES | CC(C)(C)CC1CCC(CC(C)(C)C)CC1.CC(C)(C)CCCCC(C)(C)C |
| InChI | InChI=1S/C16H32.C12H26/c1-15(2,3)11-13-7-9-14(10-8-13)12-16(4,5)6;1-11(2,3)9-7-8-10-12(4,5)6/h13-14H,7-12H2,1-6H3;7-10H2,1-6H3 |
| InChIKey | QVWGXNDZXXASMX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|