C11H22O2S — CID 159579445
4,4-dimethylpentylsulfonylmethylcyclopropane (PubChem CID 159579445) has the molecular formula C11H22O2S and a molecular weight of 218.36 g/mol. Its IUPAC name is 4,4-dimethylpentylsulfonylmethylcyclopropane.
| Compound Name | 4,4-dimethylpentylsulfonylmethylcyclopropane |
|---|---|
| PubChem CID | 159579445 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4,4-dimethylpentylsulfonylmethylcyclopropane |
| SMILES | CC(C)(C)CCCS(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C11H22O2S/c1-11(2,3)7-4-8-14(12,13)9-10-5-6-10/h10H,4-9H2,1-3H3 |
| InChIKey | WVFYWKHUTRTNLK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |