C12H21NO2S — CID 65262986
4-(cyclopentylmethylsulfonyl)-2,2-dimethylbutanenitrile (PubChem CID 65262986) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 4-(cyclopentylmethylsulfonyl)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(cyclopentylmethylsulfonyl)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65262986 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-(cyclopentylmethylsulfonyl)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCS(=O)(=O)CC1CCCC1 |
| InChI | InChI=1S/C12H21NO2S/c1-12(2,10-13)7-8-16(14,15)9-11-5-3-4-6-11/h11H,3-9H2,1-2H3 |
| InChIKey | KDFLDPLIIRTBSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |