C11H19F3O3S — CID 67249606
[4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]methanol (PubChem CID 67249606) has the molecular formula C11H19F3O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is [4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]methanol.
| Compound Name | [4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 67249606 |
| Molecular Formula | C11H19F3O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [4-(3,3,3-trifluoropropylsulfonylmethyl)cyclohexyl]methanol |
| SMILES | O=S(=O)(CCC(F)(F)F)CC1CCC(CO)CC1 |
| InChI | InChI=1S/C11H19F3O3S/c12-11(13,14)5-6-18(16,17)8-10-3-1-9(7-15)2-4-10/h9-10,15H,1-8H2 |
| InChIKey | JAOOMWSWBMPDLF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |