C10H18F3NO — CID 115034947
3-amino-2-cycloheptyl-1,1,1-trifluoropropan-2-ol (PubChem CID 115034947) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-amino-2-cycloheptyl-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-cycloheptyl-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 115034947 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-amino-2-cycloheptyl-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(C1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c11-10(12,13)9(15,7-14)8-5-3-1-2-4-6-8/h8,15H,1-7,14H2 |
| InChIKey | UOYZADVKYDKRQB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |