C13H24F3NO — CID 165457814
3-amino-2-(4-tert-butylcyclohexyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 165457814) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-amino-2-(4-tert-butylcyclohexyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(4-tert-butylcyclohexyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 165457814 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-amino-2-(4-tert-butylcyclohexyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(C)(C)C1CCC(C(O)(CN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3NO/c1-11(2,3)9-4-6-10(7-5-9)12(18,8-17)13(14,15)16/h9-10,18H,4-8,17H2,1-3H3 |
| InChIKey | NHAREYWFOONEHK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |