C12H17F6NO2S — CID 138550952
N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 138550952) has the molecular formula C12H17F6NO2S and a molecular weight of 353.33 g/mol. Its IUPAC name is N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 138550952 |
| Molecular Formula | C12H17F6NO2S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(3-cyclohexylprop-2-enyl)-1,1,1-trifluoro-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | O=S(=O)(N(CC=CC1CCCCC1)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6NO2S/c13-11(14,15)9-19(22(20,21)12(16,17)18)8-4-7-10-5-2-1-3-6-10/h4,7,10H,1-3,5-6,8-9H2 |
| InChIKey | JOSXXRPBSHBSKU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|