C17H28F3NO4S — CID 159326672
methyl (2S,3S)-2-[[(E)-3-cyclohexylprop-2-enyl]-(trifluoromethylsulfonyl)amino]-3-methylpentanoate (PubChem CID 159326672) has the molecular formula C17H28F3NO4S and a molecular weight of 399.48 g/mol. Its IUPAC name is methyl (2S,3S)-2-[[(E)-3-cyclohexylprop-2-enyl]-(trifluoromethylsulfonyl)amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[[(E)-3-cyclohexylprop-2-enyl]-(trifluoromethylsulfonyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 159326672 |
| Molecular Formula | C17H28F3NO4S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | methyl (2S,3S)-2-[[(E)-3-cyclohexylprop-2-enyl]-(trifluoromethylsulfonyl)amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)N(C/C=C/C1CCCCC1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO4S/c1-4-13(2)15(16(22)25-3)21(26(23,24)17(18,19)20)12-8-11-14-9-6-5-7-10-14/h8,11,13-15H,4-7,9-10,12H2,1-3H3/b11-8+/t13-,15-/m0/s1 |
| InChIKey | LELIEDFGDDFQNU-MHTLDOAHSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|