C11H8F12O2 — CID 141429710
1,2,2,3,3,4-hexafluoro-4-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)pentane-1,1-diol (PubChem CID 141429710) has the molecular formula C11H8F12O2 and a molecular weight of 400.16 g/mol. Its IUPAC name is 1,2,2,3,3,4-hexafluoro-4-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)pentane-1,1-diol.
| Compound Name | 1,2,2,3,3,4-hexafluoro-4-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)pentane-1,1-diol |
|---|---|
| PubChem CID | 141429710 |
| Molecular Formula | C11H8F12O2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1,2,2,3,3,4-hexafluoro-4-(1,4,5,5,6,6-hexafluorocyclohex-2-en-1-yl)pentane-1,1-diol |
| SMILES | CC(F)(C(F)(F)C(F)(F)C(O)(O)F)C1(F)C=CC(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H8F12O2/c1-5(13,8(17,18)10(21,22)11(23,24)25)6(14)3-2-4(12)7(15,16)9(6,19)20/h2-4,24-25H,1H3 |
| InChIKey | NJTGYPREPQYEIF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|