C13H4F22O2 — CID 155670552
1,1,2,2-tetrafluoro-3,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]cyclopentane (PubChem CID 155670552) has the molecular formula C13H4F22O2 and a molecular weight of 610.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]cyclopentane.
| Compound Name | 1,1,2,2-tetrafluoro-3,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]cyclopentane |
|---|---|
| PubChem CID | 155670552 |
| Molecular Formula | C13H4F22O2 |
| Molecular Weight | 610.13 g/mol |
| Exact Mass | 609.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3,3-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy]cyclopentane |
| SMILES | FC(F)(F)C(OC1(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CCC(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H4F22O2/c14-3(15)1-2-4(7(3,16)17,36-5(8(18,19)20,9(21,22)23)10(24,25)26)37-6(11(27,28)29,12(30,31)32)13(33,34)35/h1-2H2 |
| InChIKey | QSGBYMNCUWOUAS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.13 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|