C11H14F8O — CID 134374502
1,1-difluoro-4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]cyclohexane (PubChem CID 134374502) has the molecular formula C11H14F8O and a molecular weight of 314.22 g/mol. Its IUPAC name is 1,1-difluoro-4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]cyclohexane.
| Compound Name | 1,1-difluoro-4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]cyclohexane |
|---|---|
| PubChem CID | 134374502 |
| Molecular Formula | C11H14F8O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1,1-difluoro-4-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]cyclohexane |
| SMILES | CC(OCC1CCC(F)(F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F8O/c1-8(10(14,15)16,11(17,18)19)20-6-7-2-4-9(12,13)5-3-7/h7H,2-6H2,1H3 |
| InChIKey | MQFFHYVJSWQMTM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |