C11H19F2NO2 — CID 162724769
(4,4-difluorocyclohexyl)methyl 2-amino-2-methylpropanoate (PubChem CID 162724769) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methyl 2-amino-2-methylpropanoate.
| Compound Name | (4,4-difluorocyclohexyl)methyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 162724769 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)methyl 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H19F2NO2/c1-10(2,14)9(15)16-7-8-3-5-11(12,13)6-4-8/h8H,3-7,14H2,1-2H3 |
| InChIKey | ZGGRGKGSXWFJJQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |