About 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen
4-ethyl-1,1-difluorocycloheptane;molecular hydrogen (PubChem CID 178021496) has the molecular formula C9H18F2
and a molecular weight of 164.24 g/mol. Its IUPAC name is 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen.
Analyze 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen?
The IUPAC name of 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen (CID 178021496) is 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen.
What is the SMILES notation for 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen?
The canonical SMILES for 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen is CCC1CCCC(F)(F)CC1.[H][H].
What is the InChIKey of 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen?
The InChIKey is FVUROMKBFMWVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2.H2/c1-2-8-4-3-6-9(10,11)7-5-8;/h8H,2-7H2,1H3;1H.
What are the key properties of 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen?
4-ethyl-1,1-difluorocycloheptane;molecular hydrogen has a molecular weight of 164.24 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,1-difluorocycloheptane;molecular hydrogen is sourced from PubChem (CID 178021496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).