C6Br2F10 — CID 71412615
1,4-dibromo-1,2,2,3,3,4,5,5,6,6-decafluorocyclohexane (PubChem CID 71412615) has the molecular formula C6Br2F10 and a molecular weight of 421.85 g/mol. Its IUPAC name is 1,4-dibromo-1,2,2,3,3,4,5,5,6,6-decafluorocyclohexane.
| Compound Name | 1,4-dibromo-1,2,2,3,3,4,5,5,6,6-decafluorocyclohexane |
|---|---|
| PubChem CID | 71412615 |
| Molecular Formula | C6Br2F10 |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 419.82 |
| IUPAC Name | 1,4-dibromo-1,2,2,3,3,4,5,5,6,6-decafluorocyclohexane |
| SMILES | FC1(F)C(F)(F)C(F)(Br)C(F)(F)C(F)(F)C1(F)Br |
| InChI | InChI=1S/C6Br2F10/c7-1(9)3(11,12)5(15,16)2(8,10)6(17,18)4(1,13)14 |
| InChIKey | VKVNTKOKEQGVIC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|